About 4'-Bromoacetanilide
4'-Bromoacetanilide (PubChem CID 7683) has the molecular formula C8H8BrNO
and a molecular weight of 214.06 g/mol. Its IUPAC name is N-(4-bromophenyl)acetamide.
Molecular Properties
| Compound Name | 4'-Bromoacetanilide |
| PubChem CID | 7683 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | N-(4-bromophenyl)acetamide |
| SMILES | CC(=O)NC1=CC=C(C=C1)Br |
| InChI | InChI=1S/C8H8BrNO/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,1H3,(H,10,11) |
| InChIKey | MSLICLMCQYQNPK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 141 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4'-Bromoacetanilide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-Bromoacetanilide?
The IUPAC name of 4'-Bromoacetanilide (CID 7683) is N-(4-bromophenyl)acetamide.
What is the SMILES notation for 4'-Bromoacetanilide?
The canonical SMILES for 4'-Bromoacetanilide is CC(=O)NC1=CC=C(C=C1)Br.
What is the InChIKey of 4'-Bromoacetanilide?
The InChIKey is MSLICLMCQYQNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,1H3,(H,10,11).
What are the key properties of 4'-Bromoacetanilide?
4'-Bromoacetanilide has a molecular weight of 214.06 g/mol, XLogP of 2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-Bromoacetanilide is sourced from PubChem (CID 7683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).