C25H32N2O5 — CID 27604624
3,4,5-triethoxy-N-(1-propanoyl-3,4-dihydro-2H-quinolin-7-yl)benzamide (PubChem CID 27604624) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(1-propanoyl-3,4-dihydro-2H-quinolin-7-yl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(1-propanoyl-3,4-dihydro-2H-quinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 27604624 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 3,4,5-triethoxy-N-(1-propanoyl-3,4-dihydro-2H-quinolin-7-yl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3c(c2)N(C(=O)CC)CCC3)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H32N2O5/c1-5-23(28)27-13-9-10-17-11-12-19(16-20(17)27)26-25(29)18-14-21(30-6-2)24(32-8-4)22(15-18)31-7-3/h11-12,14-16H,5-10,13H2,1-4H3,(H,26,29) |
| InChIKey | WXJAYRVDAIJLRZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |