C6H4ClN3O — CID 2763296
2-chloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 2763296) has the molecular formula C6H4ClN3O and a molecular weight of 169.57 g/mol. Its IUPAC name is 2-chloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-chloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 2763296 |
| Molecular Formula | C6H4ClN3O |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 2-chloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Cc2cnc(Cl)nc2N1 |
| InChI | InChI=1S/C6H4ClN3O/c7-6-8-2-3-1-4(11)9-5(3)10-6/h2H,1H2,(H,8,9,10,11) |
| InChIKey | HJWLJBJSDPPAFY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |