C12H8Cl2N2O2 — CID 2764351
4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxamide (PubChem CID 2764351) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 2764351 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)c1cc(C(=O)c2ccc(Cl)cc2Cl)c[nH]1 |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-7-1-2-8(9(14)4-7)11(17)6-3-10(12(15)18)16-5-6/h1-5,16H,(H2,15,18) |
| InChIKey | DOXBYNLAZJGYIO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |