C26H26N2O5S2 — CID 27646577
ethyl 2-[[2-[(2S)-2-(furan-2-yl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 27646577) has the molecular formula C26H26N2O5S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is ethyl 2-[[2-[(2S)-2-(furan-2-yl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(2S)-2-(furan-2-yl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 27646577 |
| Molecular Formula | C26H26N2O5S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | ethyl 2-[[2-[(2S)-2-(furan-2-yl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)C[C@@H](c3ccco3)Sc3ccccc32)sc2c1CCCC2 |
| InChI | InChI=1S/C26H26N2O5S2/c1-2-32-26(31)24-16-8-3-5-11-19(16)35-25(24)27-22(29)15-28-17-9-4-6-12-20(17)34-21(14-23(28)30)18-10-7-13-33-18/h4,6-7,9-10,12-13,21H,2-3,5,8,11,14-15H2,1H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | OJTMHQNEEOJVAH-NRFANRHFSA-N |
| XLogP | 5.61 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |