C31H34N2O6S2 — CID 43953689
ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 43953689) has the molecular formula C31H34N2O6S2 and a molecular weight of 594.76 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 43953689 |
| Molecular Formula | C31H34N2O6S2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)CC(c3ccc(OC)c(OC)c3)Sc3ccccc32)sc2c1CCCCC2 |
| InChI | InChI=1S/C31H34N2O6S2/c1-4-39-31(36)29-20-10-6-5-7-12-24(20)41-30(29)32-27(34)18-33-21-11-8-9-13-25(21)40-26(17-28(33)35)19-14-15-22(37-2)23(16-19)38-3/h8-9,11,13-16,26H,4-7,10,12,17-18H2,1-3H3,(H,32,34) |
| InChIKey | RUWULDMRMGXQGG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |