C30H32N2O6S2 — CID 43953687
ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 43953687) has the molecular formula C30H32N2O6S2 and a molecular weight of 580.73 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 43953687 |
| Molecular Formula | C30H32N2O6S2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)CC(c3ccc(OC)c(OC)c3)Sc3ccccc32)sc2c1CCCC2 |
| InChI | InChI=1S/C30H32N2O6S2/c1-4-38-30(35)28-19-9-5-7-11-23(19)40-29(28)31-26(33)17-32-20-10-6-8-12-24(20)39-25(16-27(32)34)18-13-14-21(36-2)22(15-18)37-3/h6,8,10,12-15,25H,4-5,7,9,11,16-17H2,1-3H3,(H,31,33) |
| InChIKey | OYDGWCUKJVZWJG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |