C20H19N5O3 — CID 27649331
N-(1H-benzimidazol-2-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 27649331) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 27649331 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc([C@@]2(C)NC(=O)N(CC(=O)Nc3nc4ccccc4[nH]3)C2=O)cc1 |
| InChI | InChI=1S/C20H19N5O3/c1-12-7-9-13(10-8-12)20(2)17(27)25(19(28)24-20)11-16(26)23-18-21-14-5-3-4-6-15(14)22-18/h3-10H,11H2,1-2H3,(H,24,28)(H2,21,22,23,26)/t20-/m1/s1 |
| InChIKey | CZFCORFLPHHQKZ-HXUWFJFHSA-N |
| XLogP | 2.28 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|