C17H10F2N2O4S — CID 2765194
N-(2,4-difluorophenyl)-3-(2-nitrophenoxy)thiophene-2-carboxamide (PubChem CID 2765194) has the molecular formula C17H10F2N2O4S and a molecular weight of 376.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(2-nitrophenoxy)thiophene-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-3-(2-nitrophenoxy)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2765194 |
| Molecular Formula | C17H10F2N2O4S |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(2-nitrophenoxy)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1sccc1Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10F2N2O4S/c18-10-5-6-12(11(19)9-10)20-17(22)16-15(7-8-26-16)25-14-4-2-1-3-13(14)21(23)24/h1-9H,(H,20,22) |
| InChIKey | HKGNKXQMHNMFRP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|