C22H24N2O3S — CID 27656690
1-(4-morpholin-4-ylsulfonylphenyl)-N-(naphthalen-2-ylmethyl)methanamine (PubChem CID 27656690) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylsulfonylphenyl)-N-(naphthalen-2-ylmethyl)methanamine.
| Compound Name | 1-(4-morpholin-4-ylsulfonylphenyl)-N-(naphthalen-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 27656690 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-(4-morpholin-4-ylsulfonylphenyl)-N-(naphthalen-2-ylmethyl)methanamine |
| SMILES | O=S(=O)(c1ccc(CNCc2ccc3ccccc3c2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H24N2O3S/c25-28(26,24-11-13-27-14-12-24)22-9-6-18(7-10-22)16-23-17-19-5-8-20-3-1-2-4-21(20)15-19/h1-10,15,23H,11-14,16-17H2 |
| InChIKey | GVHFMUMOWLMRSC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |