C23H26N2O4S — CID 112811153
2-ethoxy-5-morpholin-4-ylsulfonyl-N-(naphthalen-2-ylmethyl)aniline (PubChem CID 112811153) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-ethoxy-5-morpholin-4-ylsulfonyl-N-(naphthalen-2-ylmethyl)aniline.
| Compound Name | 2-ethoxy-5-morpholin-4-ylsulfonyl-N-(naphthalen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 112811153 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-ethoxy-5-morpholin-4-ylsulfonyl-N-(naphthalen-2-ylmethyl)aniline |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOCC2)cc1NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-2-29-23-10-9-21(30(26,27)25-11-13-28-14-12-25)16-22(23)24-17-18-7-8-19-5-3-4-6-20(19)15-18/h3-10,15-16,24H,2,11-14,17H2,1H3 |
| InChIKey | LLKQOBISGSBKCE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |