C22H30N2O6S2 — CID 26952024
4-tert-butyl-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)benzenesulfonamide (PubChem CID 26952024) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26952024 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 4-tert-butyl-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOCC2)cc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-5-30-21-11-10-19(32(27,28)24-12-14-29-15-13-24)16-20(21)23-31(25,26)18-8-6-17(7-9-18)22(2,3)4/h6-11,16,23H,5,12-15H2,1-4H3 |
| InChIKey | KNLPRXYAYSHCJK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |