C19H23ClN4O2 — CID 27657772
N-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine (PubChem CID 27657772) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine.
| Compound Name | N-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 27657772 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine |
| SMILES | COc1cc(CNCCc2nnc3ccccn23)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C19H23ClN4O2/c1-13(2)26-19-15(20)10-14(11-16(19)25-3)12-21-8-7-18-23-22-17-6-4-5-9-24(17)18/h4-6,9-11,13,21H,7-8,12H2,1-3H3 |
| InChIKey | NVERFBXKCPUAAD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|