C19H22INO4S — CID 2766349
[2,5-dimethyl-4-(morpholin-4-ylmethyl)phenyl] 4-iodobenzenesulfonate (PubChem CID 2766349) has the molecular formula C19H22INO4S and a molecular weight of 487.36 g/mol. Its IUPAC name is [2,5-dimethyl-4-(morpholin-4-ylmethyl)phenyl] 4-iodobenzenesulfonate.
| Compound Name | [2,5-dimethyl-4-(morpholin-4-ylmethyl)phenyl] 4-iodobenzenesulfonate |
|---|---|
| PubChem CID | 2766349 |
| Molecular Formula | C19H22INO4S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | [2,5-dimethyl-4-(morpholin-4-ylmethyl)phenyl] 4-iodobenzenesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)c2ccc(I)cc2)c(C)cc1CN1CCOCC1 |
| InChI | InChI=1S/C19H22INO4S/c1-14-12-19(25-26(22,23)18-5-3-17(20)4-6-18)15(2)11-16(14)13-21-7-9-24-10-8-21/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | SELXYMKGWBBKCG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|