C19H21BrN2O3 — CID 27666419
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 27666419) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 27666419 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H21BrN2O3/c20-14-6-7-15-16(12-14)19(25)22(18(15)24)11-9-17(23)21-10-8-13-4-2-1-3-5-13/h4,6-7,12H,1-3,5,8-11H2,(H,21,23) |
| InChIKey | LETVLOXDUOLKBM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|