C21H19ClF3N5O — CID 2767083
5-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-methyl-1-phenylpyrazole-4-carbaldehyde (PubChem CID 2767083) has the molecular formula C21H19ClF3N5O and a molecular weight of 449.86 g/mol. Its IUPAC name is 5-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-methyl-1-phenylpyrazole-4-carbaldehyde.
| Compound Name | 5-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-methyl-1-phenylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 2767083 |
| Molecular Formula | C21H19ClF3N5O |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-methyl-1-phenylpyrazole-4-carbaldehyde |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)c1C=O |
| InChI | InChI=1S/C21H19ClF3N5O/c1-14-17(13-31)20(30(27-14)16-5-3-2-4-6-16)29-9-7-28(8-10-29)19-18(22)11-15(12-26-19)21(23,24)25/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | NMOXRJUJLFRRKZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|