C13H17ClF3N3O2S — CID 55353279
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-propylsulfonylpiperazine (PubChem CID 55353279) has the molecular formula C13H17ClF3N3O2S and a molecular weight of 371.81 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-propylsulfonylpiperazine.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-propylsulfonylpiperazine |
|---|---|
| PubChem CID | 55353279 |
| Molecular Formula | C13H17ClF3N3O2S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-propylsulfonylpiperazine |
| SMILES | CCCS(=O)(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C13H17ClF3N3O2S/c1-2-7-23(21,22)20-5-3-19(4-6-20)12-11(14)8-10(9-18-12)13(15,16)17/h8-9H,2-7H2,1H3 |
| InChIKey | AFJLERDFPYHXPD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |