C15H22ClF3N4O2S — CID 55627120
N-butyl-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methylpiperazine-1-sulfonamide (PubChem CID 55627120) has the molecular formula C15H22ClF3N4O2S and a molecular weight of 414.88 g/mol. Its IUPAC name is N-butyl-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-butyl-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55627120 |
| Molecular Formula | C15H22ClF3N4O2S |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-butyl-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methylpiperazine-1-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C15H22ClF3N4O2S/c1-3-4-5-21(2)26(24,25)23-8-6-22(7-9-23)14-13(16)10-12(11-20-14)15(17,18)19/h10-11H,3-9H2,1-2H3 |
| InChIKey | RFLOWKGVZFHBMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |