About 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate
3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate (PubChem CID 2769590) has the molecular formula C10H9NO7
and a molecular weight of 255.18 g/mol. Its IUPAC name is 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate.
Molecular Properties
| Compound Name | 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate |
| PubChem CID | 2769590 |
| Molecular Formula | C10H9NO7 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate |
| SMILES | O.O=C/C(=C\O)c1cc(C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7NO6.H2O/c12-4-7(5-13)8-3-6(10(14)15)1-2-9(8)11(16)17;/h1-5,12H,(H,14,15);1H2/b7-4+; |
| InChIKey | AZHSUYDMDYFJON-KQGICBIGSA-N |
| XLogP | 0.57 |
| TPSA | 149.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate?
The IUPAC name of 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate (CID 2769590) is 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate.
What is the SMILES notation for 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate?
The canonical SMILES for 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate is O.O=C/C(=C\O)c1cc(C(=O)O)ccc1[N+](=O)[O-].
What is the InChIKey of 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate?
The InChIKey is AZHSUYDMDYFJON-KQGICBIGSA-N. The full InChI is InChI=1S/C10H7NO6.H2O/c12-4-7(5-13)8-3-6(10(14)15)1-2-9(8)11(16)17;/h1-5,12H,(H,14,15);1H2/b7-4+;.
What are the key properties of 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate?
3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate has a molecular weight of 255.18 g/mol, XLogP of 0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]-4-nitrobenzoic acid;hydrate is sourced from PubChem (CID 2769590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).