C12H14FNO2 — CID 2771854
5-fluoro-3-(4-hydroxybutyl)-1,3-dihydroindol-2-one (PubChem CID 2771854) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 5-fluoro-3-(4-hydroxybutyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-(4-hydroxybutyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 2771854 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-fluoro-3-(4-hydroxybutyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1CCCCO |
| InChI | InChI=1S/C12H14FNO2/c13-8-4-5-11-10(7-8)9(12(16)14-11)3-1-2-6-15/h4-5,7,9,15H,1-3,6H2,(H,14,16) |
| InChIKey | BJTPHHHQUXBPKI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|