About 3,4-diaminophenol
3,4-diaminophenol (PubChem CID 2772970) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 3,4-diaminophenol.
Molecular Properties
| Compound Name | 3,4-diaminophenol |
| PubChem CID | 2772970 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 3,4-diaminophenol |
| SMILES | Nc1ccc(O)cc1N |
| InChI | InChI=1S/C6H8N2O/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,7-8H2 |
| InChIKey | OVOZYARDXPHRDL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminophenol?
The IUPAC name of 3,4-diaminophenol (CID 2772970) is 3,4-diaminophenol.
What is the SMILES notation for 3,4-diaminophenol?
The canonical SMILES for 3,4-diaminophenol is Nc1ccc(O)cc1N.
What is the InChIKey of 3,4-diaminophenol?
The InChIKey is OVOZYARDXPHRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,7-8H2.
What are the key properties of 3,4-diaminophenol?
3,4-diaminophenol has a molecular weight of 124.14 g/mol, XLogP of 0.56, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminophenol is sourced from PubChem (CID 2772970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).