C19H20N4OS — CID 2773019
1-(2-phenoxyethylsulfanyl)-4-propan-2-yl-[1,2,4]triazolo[4,3-a]benzimidazole (PubChem CID 2773019) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(2-phenoxyethylsulfanyl)-4-propan-2-yl-[1,2,4]triazolo[4,3-a]benzimidazole.
| Compound Name | 1-(2-phenoxyethylsulfanyl)-4-propan-2-yl-[1,2,4]triazolo[4,3-a]benzimidazole |
|---|---|
| PubChem CID | 2773019 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(2-phenoxyethylsulfanyl)-4-propan-2-yl-[1,2,4]triazolo[4,3-a]benzimidazole |
| SMILES | CC(C)n1c2ccccc2n2c(SCCOc3ccccc3)nnc12 |
| InChI | InChI=1S/C19H20N4OS/c1-14(2)22-16-10-6-7-11-17(16)23-18(22)20-21-19(23)25-13-12-24-15-8-4-3-5-9-15/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | QWPQAVNMCVYVIL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|