C23H29N3O4S — CID 43869735
3-[1-(2-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole (PubChem CID 43869735) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-[1-(2-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-[1-(2-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 43869735 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 3-[1-(2-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
| SMILES | COc1ccc(OCCSc2nnc(C(C)Oc3ccccc3OC)n2C(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-16(2)26-22(17(3)30-21-9-7-6-8-20(21)28-5)24-25-23(26)31-15-14-29-19-12-10-18(27-4)11-13-19/h6-13,16-17H,14-15H2,1-5H3 |
| InChIKey | XJSJMIPSZCFVKG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|