C24H31N3O4S — CID 43884145
3-[1-(4-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazole (PubChem CID 43884145) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-[1-(4-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 43884145 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-[1-(4-methoxyphenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazole |
| SMILES | COc1ccc(OCCSc2nnc(C(C)Oc3ccc(OC)cc3)n2CC(C)C)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-17(2)16-27-23(18(3)31-22-12-8-20(29-5)9-13-22)25-26-24(27)32-15-14-30-21-10-6-19(28-4)7-11-21/h6-13,17-18H,14-16H2,1-5H3 |
| InChIKey | ILNYHONPEFBIJR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|