C22H26FN3O3S — CID 43868643
3-[1-(4-fluorophenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole (PubChem CID 43868643) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-[1-(4-fluorophenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-[1-(4-fluorophenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 43868643 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-[1-(4-fluorophenoxy)ethyl]-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
| SMILES | COc1ccc(OCCSc2nnc(C(C)Oc3ccc(F)cc3)n2C(C)C)cc1 |
| InChI | InChI=1S/C22H26FN3O3S/c1-15(2)26-21(16(3)29-20-7-5-17(23)6-8-20)24-25-22(26)30-14-13-28-19-11-9-18(27-4)10-12-19/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | KKJUBOLDBSRFOM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|