C19H23N3O2P+ — CID 2776749
(5-acetyl-2-methoxyphenyl)methyl-tris(2-cyanoethyl)phosphanium (PubChem CID 2776749) has the molecular formula C19H23N3O2P+ and a molecular weight of 356.39 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl-tris(2-cyanoethyl)phosphanium.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl-tris(2-cyanoethyl)phosphanium |
|---|---|
| PubChem CID | 2776749 |
| Molecular Formula | C19H23N3O2P+ |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl-tris(2-cyanoethyl)phosphanium |
| SMILES | COc1ccc(C(C)=O)cc1C[P+](CCC#N)(CCC#N)CCC#N |
| InChI | InChI=1S/C19H23N3O2P/c1-16(23)17-6-7-19(24-2)18(14-17)15-25(11-3-8-20,12-4-9-21)13-5-10-22/h6-7,14H,3-5,11-13,15H2,1-2H3/q+1 |
| InChIKey | KWJRTMXXYRQQIL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|