C17H12Cl3NO — CID 2777003
4-[chloro(phenyl)methyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole (PubChem CID 2777003) has the molecular formula C17H12Cl3NO and a molecular weight of 352.65 g/mol. Its IUPAC name is 4-[chloro(phenyl)methyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole.
| Compound Name | 4-[chloro(phenyl)methyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 2777003 |
| Molecular Formula | C17H12Cl3NO |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-[chloro(phenyl)methyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(Cl)c1ccccc1 |
| InChI | InChI=1S/C17H12Cl3NO/c1-10-14(16(20)11-6-3-2-4-7-11)17(21-22-10)15-12(18)8-5-9-13(15)19/h2-9,16H,1H3 |
| InChIKey | VFLLEPGFEZXGRY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|