C20H26ClN3O5S — CID 27772574
N-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]-2-[(1S)-cyclopent-2-en-1-yl]-N-methylacetamide (PubChem CID 27772574) has the molecular formula C20H26ClN3O5S and a molecular weight of 455.96 g/mol. Its IUPAC name is N-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]-2-[(1S)-cyclopent-2-en-1-yl]-N-methylacetamide.
| Compound Name | N-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]-2-[(1S)-cyclopent-2-en-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 27772574 |
| Molecular Formula | C20H26ClN3O5S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]-2-[(1S)-cyclopent-2-en-1-yl]-N-methylacetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)C(=O)C[C@H]1C=CCC1 |
| InChI | InChI=1S/C20H26ClN3O5S/c1-23(20(26)12-15-4-2-3-5-15)14-19(25)22-16-6-7-17(21)18(13-16)30(27,28)24-8-10-29-11-9-24/h2,4,6-7,13,15H,3,5,8-12,14H2,1H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | MDSMPYPWCKGFLK-HNNXBMFYSA-N |
| XLogP | 2.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|