C21H24N4O3S2 — CID 27778826
phenyl 2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]ethanesulfonate (PubChem CID 27778826) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is phenyl 2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]ethanesulfonate.
| Compound Name | phenyl 2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]ethanesulfonate |
|---|---|
| PubChem CID | 27778826 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | phenyl 2-[(4-phenyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]ethanesulfonate |
| SMILES | O=S(=O)(CCSc1nnc(N2CCCCC2)n1-c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C21H24N4O3S2/c26-30(27,28-19-12-6-2-7-13-19)17-16-29-21-23-22-20(24-14-8-3-9-15-24)25(21)18-10-4-1-5-11-18/h1-2,4-7,10-13H,3,8-9,14-17H2 |
| InChIKey | URLFGCZTCDWLQY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|