C29H25NO4 — CID 27790916
[3-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2,2-diphenylacetate (PubChem CID 27790916) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is [3-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2,2-diphenylacetate.
| Compound Name | [3-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 27790916 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [3-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2,2-diphenylacetate |
| SMILES | C[C@@H]1C=CC[C@@H]2C(=O)N(c3cccc(OC(=O)C(c4ccccc4)c4ccccc4)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H25NO4/c1-19-10-8-17-24-25(19)28(32)30(27(24)31)22-15-9-16-23(18-22)34-29(33)26(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-16,18-19,24-26H,17H2,1H3/t19-,24+,25-/m1/s1 |
| InChIKey | KFIDCYBRMCFOOS-BTZRARBUSA-N |
| XLogP | 5.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|