C11H14N2O2 — CID 2779664
N-(3-formyl-4-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 2779664) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-(3-formyl-4-pyridinyl)-2,2-dimethylpropanamide.
| Compound Name | N-(3-formyl-4-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2779664 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-(3-formyl-4-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccncc1C=O |
| InChI | InChI=1S/C11H14N2O2/c1-11(2,3)10(15)13-9-4-5-12-6-8(9)7-14/h4-7H,1-3H3,(H,12,13,15) |
| InChIKey | ICMXCEJBHWHTBH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|