C14H18N2O4 — CID 90842056
[4-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2-oxobutanoate (PubChem CID 90842056) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [4-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2-oxobutanoate.
| Compound Name | [4-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2-oxobutanoate |
|---|---|
| PubChem CID | 90842056 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [4-(2,2-dimethylpropanoylamino)-3-pyridinyl] 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)Oc1cnccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H18N2O4/c1-5-10(17)12(18)20-11-8-15-7-6-9(11)16-13(19)14(2,3)4/h6-8H,5H2,1-4H3,(H,15,16,19) |
| InChIKey | YVKXBCLYODAUOK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|