C12H16N2O2 — CID 118192456
N-(3-formyl-2-methyl-4-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 118192456) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-(3-formyl-2-methyl-4-pyridinyl)-2,2-dimethylpropanamide.
| Compound Name | N-(3-formyl-2-methyl-4-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 118192456 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-(3-formyl-2-methyl-4-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | Cc1nccc(NC(=O)C(C)(C)C)c1C=O |
| InChI | InChI=1S/C12H16N2O2/c1-8-9(7-15)10(5-6-13-8)14-11(16)12(2,3)4/h5-7H,1-4H3,(H,13,14,16) |
| InChIKey | JPDOLHZSYXFBSX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|