C14H17NO5 — CID 21082629
2-[3-(2,2-dimethylpropanoylamino)-2-formylphenoxy]acetic acid (PubChem CID 21082629) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropanoylamino)-2-formylphenoxy]acetic acid.
| Compound Name | 2-[3-(2,2-dimethylpropanoylamino)-2-formylphenoxy]acetic acid |
|---|---|
| PubChem CID | 21082629 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[3-(2,2-dimethylpropanoylamino)-2-formylphenoxy]acetic acid |
| SMILES | CC(C)(C)C(=O)Nc1cccc(OCC(=O)O)c1C=O |
| InChI | InChI=1S/C14H17NO5/c1-14(2,3)13(19)15-10-5-4-6-11(9(10)7-16)20-8-12(17)18/h4-7H,8H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | XBSCIIYMZFSISM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|