C19H22BNO5 — CID 166428746
[3-[2-(2-tert-butylanilino)-2-oxoethoxy]-2-formylphenyl]boronic acid (PubChem CID 166428746) has the molecular formula C19H22BNO5 and a molecular weight of 355.20 g/mol. Its IUPAC name is [3-[2-(2-tert-butylanilino)-2-oxoethoxy]-2-formylphenyl]boronic acid.
| Compound Name | [3-[2-(2-tert-butylanilino)-2-oxoethoxy]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166428746 |
| Molecular Formula | C19H22BNO5 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [3-[2-(2-tert-butylanilino)-2-oxoethoxy]-2-formylphenyl]boronic acid |
| SMILES | CC(C)(C)c1ccccc1NC(=O)COc1cccc(B(O)O)c1C=O |
| InChI | InChI=1S/C19H22BNO5/c1-19(2,3)14-7-4-5-9-16(14)21-18(23)12-26-17-10-6-8-15(20(24)25)13(17)11-22/h4-11,24-25H,12H2,1-3H3,(H,21,23) |
| InChIKey | TVMFMDDNQROQHE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|