C19H22BNO6 — CID 166428798
[2-formyl-3-[2-oxo-2-[(4-propoxyphenyl)methylamino]ethoxy]phenyl]boronic acid (PubChem CID 166428798) has the molecular formula C19H22BNO6 and a molecular weight of 371.20 g/mol. Its IUPAC name is [2-formyl-3-[2-oxo-2-[(4-propoxyphenyl)methylamino]ethoxy]phenyl]boronic acid.
| Compound Name | [2-formyl-3-[2-oxo-2-[(4-propoxyphenyl)methylamino]ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 166428798 |
| Molecular Formula | C19H22BNO6 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [2-formyl-3-[2-oxo-2-[(4-propoxyphenyl)methylamino]ethoxy]phenyl]boronic acid |
| SMILES | CCCOc1ccc(CNC(=O)COc2cccc(B(O)O)c2C=O)cc1 |
| InChI | InChI=1S/C19H22BNO6/c1-2-10-26-15-8-6-14(7-9-15)11-21-19(23)13-27-18-5-3-4-17(20(24)25)16(18)12-22/h3-9,12,24-25H,2,10-11,13H2,1H3,(H,21,23) |
| InChIKey | QLCSEWORMPLCPK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|