C14H19NO4 — CID 21082663
N-[2-formyl-3-(methoxymethoxy)phenyl]-2,2-dimethylpropanamide (PubChem CID 21082663) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[2-formyl-3-(methoxymethoxy)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-formyl-3-(methoxymethoxy)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 21082663 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[2-formyl-3-(methoxymethoxy)phenyl]-2,2-dimethylpropanamide |
| SMILES | COCOc1cccc(NC(=O)C(C)(C)C)c1C=O |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)13(17)15-11-6-5-7-12(10(11)8-16)19-9-18-4/h5-8H,9H2,1-4H3,(H,15,17) |
| InChIKey | DUYMICJYPJVUJI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|