C7H10N2O3S — CID 2779747
2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetic acid (PubChem CID 2779747) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetic acid.
| Compound Name | 2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetic acid |
|---|---|
| PubChem CID | 2779747 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetic acid |
| SMILES | C/N=C1\SC(CC(=O)O)C(=O)N1C |
| InChI | InChI=1S/C7H10N2O3S/c1-8-7-9(2)6(12)4(13-7)3-5(10)11/h4H,3H2,1-2H3,(H,10,11)/b8-7- |
| InChIKey | JYCIIMYFSHYOEI-FPLPWBNLSA-N |
| XLogP | 0.02 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|