C8H12N4O3S — CID 3155076
N-carbamoyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 3155076) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is N-carbamoyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-carbamoyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 3155076 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-carbamoyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | C/N=C1\SC(CC(=O)NC(N)=O)C(=O)N1C |
| InChI | InChI=1S/C8H12N4O3S/c1-10-8-12(2)6(14)4(16-8)3-5(13)11-7(9)15/h4H,3H2,1-2H3,(H3,9,11,13,15)/b10-8- |
| InChIKey | YMOCTEYVGBOTDC-NTMALXAHSA-N |
| XLogP | -0.87 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|