C8H13N3O2S — CID 3150957
N-methyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 3150957) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is N-methyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-methyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 3150957 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-methyl-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | C/N=C1\SC(CC(=O)NC)C(=O)N1C |
| InChI | InChI=1S/C8H13N3O2S/c1-9-6(12)4-5-7(13)11(3)8(10-2)14-5/h5H,4H2,1-3H3,(H,9,12)/b10-8- |
| InChIKey | ZAIZHHMBPBZIQL-NTMALXAHSA-N |
| XLogP | -0.32 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|