C12H10Cl2O3 — CID 2780047
(E)-2,3-dichloro-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid (PubChem CID 2780047) has the molecular formula C12H10Cl2O3 and a molecular weight of 273.12 g/mol. Its IUPAC name is (E)-2,3-dichloro-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-2,3-dichloro-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2780047 |
| Molecular Formula | C12H10Cl2O3 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | (E)-2,3-dichloro-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid |
| SMILES | Cc1ccc(C)c(C(=O)/C(Cl)=C(\Cl)C(=O)O)c1 |
| InChI | InChI=1S/C12H10Cl2O3/c1-6-3-4-7(2)8(5-6)11(15)9(13)10(14)12(16)17/h3-5H,1-2H3,(H,16,17)/b10-9+ |
| InChIKey | SZYIVTYQGGBQGW-MDZDMXLPSA-N |
| XLogP | 3.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|