C26H24N3O5+ — CID 2781141
ethyl 4-[[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl]amino]benzoate (PubChem CID 2781141) has the molecular formula C26H24N3O5+ and a molecular weight of 458.49 g/mol. Its IUPAC name is ethyl 4-[[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 2781141 |
| Molecular Formula | C26H24N3O5+ |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethyl 4-[[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-pyridin-1-ium-1-ylpyrrol-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC2=C([n+]3ccccc3)C(=O)N(Cc3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O5/c1-3-34-26(32)19-9-11-20(12-10-19)27-22-23(28-15-5-4-6-16-28)25(31)29(24(22)30)17-18-7-13-21(33-2)14-8-18/h4-16H,3,17H2,1-2H3/p+1 |
| InChIKey | NIYPUONYNVAMTP-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|