C24H20Cl2N3O3+ — CID 2781143
3-(3,4-dichloroanilino)-1-[(4-methoxyphenyl)methyl]-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione (PubChem CID 2781143) has the molecular formula C24H20Cl2N3O3+ and a molecular weight of 469.35 g/mol. Its IUPAC name is 3-(3,4-dichloroanilino)-1-[(4-methoxyphenyl)methyl]-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dichloroanilino)-1-[(4-methoxyphenyl)methyl]-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 2781143 |
| Molecular Formula | C24H20Cl2N3O3+ |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-(3,4-dichloroanilino)-1-[(4-methoxyphenyl)methyl]-4-(4-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C(Nc3ccc(Cl)c(Cl)c3)=C([n+]3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O3/c1-15-9-11-28(12-10-15)22-21(27-17-5-8-19(25)20(26)13-17)23(30)29(24(22)31)14-16-3-6-18(32-2)7-4-16/h3-13H,14H2,1-2H3/p+1 |
| InChIKey | CEWALDUVULBWGL-UHFFFAOYSA-O |
| XLogP | 4.45 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|