C7H6N2S — CID 2781262
4-methyl-2,1,3-benzothiadiazole (PubChem CID 2781262) has the molecular formula C7H6N2S and a molecular weight of 150.21 g/mol. Its IUPAC name is 4-methyl-2,1,3-benzothiadiazole.
| Compound Name | 4-methyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 2781262 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4-methyl-2,1,3-benzothiadiazole |
| SMILES | Cc1cccc2nsnc12 |
| InChI | InChI=1S/C7H6N2S/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3 |
| InChIKey | IYZKISWGGPKREZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |