C14H8N4O2S — CID 27816725
4-imidazo[1,5-a]pyridin-3-ylsulfanyl-3-nitrobenzonitrile (PubChem CID 27816725) has the molecular formula C14H8N4O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-imidazo[1,5-a]pyridin-3-ylsulfanyl-3-nitrobenzonitrile.
| Compound Name | 4-imidazo[1,5-a]pyridin-3-ylsulfanyl-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 27816725 |
| Molecular Formula | C14H8N4O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-imidazo[1,5-a]pyridin-3-ylsulfanyl-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(Sc2ncc3ccccn23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8N4O2S/c15-8-10-4-5-13(12(7-10)18(19)20)21-14-16-9-11-3-1-2-6-17(11)14/h1-7,9H |
| InChIKey | UQOXBXINJLGGLU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|