C16H10N4O2S — CID 32680217
5-imidazo[1,5-a]pyridin-3-ylsulfanyl-8-nitroisoquinoline (PubChem CID 32680217) has the molecular formula C16H10N4O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 5-imidazo[1,5-a]pyridin-3-ylsulfanyl-8-nitroisoquinoline.
| Compound Name | 5-imidazo[1,5-a]pyridin-3-ylsulfanyl-8-nitroisoquinoline |
|---|---|
| PubChem CID | 32680217 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-imidazo[1,5-a]pyridin-3-ylsulfanyl-8-nitroisoquinoline |
| SMILES | O=[N+]([O-])c1ccc(Sc2ncc3ccccn23)c2ccncc12 |
| InChI | InChI=1S/C16H10N4O2S/c21-20(22)14-4-5-15(12-6-7-17-10-13(12)14)23-16-18-9-11-3-1-2-8-19(11)16/h1-10H |
| InChIKey | WMADQCKSTCRXRM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|