C15H10N6O2S2 — CID 133369737
3-(8-nitroisoquinolin-5-yl)sulfanyl-5-thiophen-2-yl-1,2,4-triazol-4-amine (PubChem CID 133369737) has the molecular formula C15H10N6O2S2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-(8-nitroisoquinolin-5-yl)sulfanyl-5-thiophen-2-yl-1,2,4-triazol-4-amine.
| Compound Name | 3-(8-nitroisoquinolin-5-yl)sulfanyl-5-thiophen-2-yl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 133369737 |
| Molecular Formula | C15H10N6O2S2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-(8-nitroisoquinolin-5-yl)sulfanyl-5-thiophen-2-yl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(Sc2ccc([N+](=O)[O-])c3cnccc23)nnc1-c1cccs1 |
| InChI | InChI=1S/C15H10N6O2S2/c16-20-14(13-2-1-7-24-13)18-19-15(20)25-12-4-3-11(21(22)23)10-8-17-6-5-9(10)12/h1-8H,16H2 |
| InChIKey | FRAZNEGUMXCDHY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|