C21H9F9N4O2S2 — CID 2797675
4-[3,5-bis(trifluoromethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 2797675) has the molecular formula C21H9F9N4O2S2 and a molecular weight of 584.45 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 2797675 |
| Molecular Formula | C21H9F9N4O2S2 |
| Molecular Weight | 584.45 g/mol |
| Exact Mass | 584.00 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Sc1nnc(-c2cccs2)n1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H9F9N4O2S2/c22-19(23,24)10-3-4-15(14(9-10)34(35)36)38-18-32-31-17(16-2-1-5-37-16)33(18)13-7-11(20(25,26)27)6-12(8-13)21(28,29)30/h1-9H |
| InChIKey | VKPHYOHXDRUAHS-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.45 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|