C26H27N3O5S — CID 27832792
N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide (PubChem CID 27832792) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
|---|---|
| PubChem CID | 27832792 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C)cc(NC(=O)CCCN2C(=O)c3cccc4cccc(c34)C2=O)c1C |
| InChI | InChI=1S/C26H27N3O5S/c1-16-14-19(35(33,34)28(3)4)15-22(17(16)2)27-23(30)12-7-13-29-25(31)20-10-5-8-18-9-6-11-21(24(18)20)26(29)32/h5-6,8-11,14-15H,7,12-13H2,1-4H3,(H,27,30) |
| InChIKey | FOVUGYOEHGPPAW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|