C30H56IN2P — CID 2783716
1,3-didecyl-5-methyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide (PubChem CID 2783716) has the molecular formula C30H56IN2P and a molecular weight of 602.67 g/mol. Its IUPAC name is 1,3-didecyl-5-methyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide.
| Compound Name | 1,3-didecyl-5-methyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide |
|---|---|
| PubChem CID | 2783716 |
| Molecular Formula | C30H56IN2P |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 1,3-didecyl-5-methyl-5-phenyl-1,3,5-diazaphosphinan-5-ium iodide |
| SMILES | CCCCCCCCCCN1CN(CCCCCCCCCC)C[P+](C)(c2ccccc2)C1.[I-] |
| InChI | InChI=1S/C30H56N2P.HI/c1-4-6-8-10-12-14-16-21-25-31-27-32(26-22-17-15-13-11-9-7-5-2)29-33(3,28-31)30-23-19-18-20-24-30;/h18-20,23-24H,4-17,21-22,25-29H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FSNZNEKKEBVIQP-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|